About 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride
2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride (PubChem CID 159447915) has the molecular formula C8H12Cl3N3O
and a molecular weight of 272.56 g/mol. Its IUPAC name is 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride |
| PubChem CID | 159447915 |
| Molecular Formula | C8H12Cl3N3O |
| Molecular Weight | 272.56 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride |
| SMILES | Cl.Cl.NC(CNc1cccc(Cl)c1)=NO |
| InChI | InChI=1S/C8H10ClN3O.2ClH/c9-6-2-1-3-7(4-6)11-5-8(10)12-13;;/h1-4,11,13H,5H2,(H2,10,12);2*1H |
| InChIKey | LSZMBTSIYMRWCM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride?
The IUPAC name of 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride (CID 159447915) is 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride.
What is the SMILES notation for 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride?
The canonical SMILES for 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride is Cl.Cl.NC(CNc1cccc(Cl)c1)=NO.
What is the InChIKey of 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride?
The InChIKey is LSZMBTSIYMRWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3O.2ClH/c9-6-2-1-3-7(4-6)11-5-8(10)12-13;;/h1-4,11,13H,5H2,(H2,10,12);2*1H.
What are the key properties of 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride?
2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride has a molecular weight of 272.56 g/mol, XLogP of 2.34, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloroanilino)-N'-hydroxyethanimidamide;dihydrochloride is sourced from PubChem (CID 159447915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).