About 2-(3-chlorophenyl)-N'-hydroxyethanimidamide
2-(3-chlorophenyl)-N'-hydroxyethanimidamide (PubChem CID 16775239) has the molecular formula C8H9ClN2O
and a molecular weight of 184.63 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-N'-hydroxyethanimidamide |
| PubChem CID | 16775239 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 2-(3-chlorophenyl)-N'-hydroxyethanimidamide |
| SMILES | N/C(Cc1cccc(Cl)c1)=N\O |
| InChI | InChI=1S/C8H9ClN2O/c9-7-3-1-2-6(4-7)5-8(10)11-12/h1-4,12H,5H2,(H2,10,11) |
| InChIKey | JUTJREHZYDXQBH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenyl)-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-N'-hydroxyethanimidamide?
The IUPAC name of 2-(3-chlorophenyl)-N'-hydroxyethanimidamide (CID 16775239) is 2-(3-chlorophenyl)-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-(3-chlorophenyl)-N'-hydroxyethanimidamide?
The canonical SMILES for 2-(3-chlorophenyl)-N'-hydroxyethanimidamide is N/C(Cc1cccc(Cl)c1)=N\O.
What is the InChIKey of 2-(3-chlorophenyl)-N'-hydroxyethanimidamide?
The InChIKey is JUTJREHZYDXQBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O/c9-7-3-1-2-6(4-7)5-8(10)11-12/h1-4,12H,5H2,(H2,10,11).
What are the key properties of 2-(3-chlorophenyl)-N'-hydroxyethanimidamide?
2-(3-chlorophenyl)-N'-hydroxyethanimidamide has a molecular weight of 184.63 g/mol, XLogP of 1.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-N'-hydroxyethanimidamide is sourced from PubChem (CID 16775239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).