C11H15ClN2O — CID 63181484
2-(3-chlorophenyl)-N'-(2-methoxyethyl)ethanimidamide (PubChem CID 63181484) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N'-(2-methoxyethyl)ethanimidamide.
| Compound Name | 2-(3-chlorophenyl)-N'-(2-methoxyethyl)ethanimidamide |
|---|---|
| PubChem CID | 63181484 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-(3-chlorophenyl)-N'-(2-methoxyethyl)ethanimidamide |
| SMILES | COCC/N=C(\N)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O/c1-15-6-5-14-11(13)8-9-3-2-4-10(12)7-9/h2-4,7H,5-6,8H2,1H3,(H2,13,14) |
| InChIKey | HYTZFKXBXVLBTR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|