C17H19ClN2O — CID 70693458
N'-[2-(3-chlorophenoxy)ethyl]-2-(3-methylphenyl)ethanimidamide (PubChem CID 70693458) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is N'-[2-(3-chlorophenoxy)ethyl]-2-(3-methylphenyl)ethanimidamide.
| Compound Name | N'-[2-(3-chlorophenoxy)ethyl]-2-(3-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 70693458 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N'-[2-(3-chlorophenoxy)ethyl]-2-(3-methylphenyl)ethanimidamide |
| SMILES | Cc1cccc(C/C(N)=N/CCOc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H19ClN2O/c1-13-4-2-5-14(10-13)11-17(19)20-8-9-21-16-7-3-6-15(18)12-16/h2-7,10,12H,8-9,11H2,1H3,(H2,19,20) |
| InChIKey | OPNBBUUVTJINFU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|