C15H22ClN3O — CID 110920552
N'-[2-(3-chlorophenoxy)ethyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110920552) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is N'-[2-(3-chlorophenoxy)ethyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(3-chlorophenoxy)ethyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110920552 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N'-[2-(3-chlorophenoxy)ethyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCOc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C15H22ClN3O/c1-12-5-8-19(9-6-12)15(17)18-7-10-20-14-4-2-3-13(16)11-14/h2-4,11-12H,5-10H2,1H3,(H2,17,18) |
| InChIKey | BIMOCCMLELRSCC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|