C16H26IN3O — CID 110919520
4-methyl-N'-(3-phenoxypropyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 110919520) has the molecular formula C16H26IN3O and a molecular weight of 403.31 g/mol. Its IUPAC name is 4-methyl-N'-(3-phenoxypropyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-(3-phenoxypropyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110919520 |
| Molecular Formula | C16H26IN3O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-methyl-N'-(3-phenoxypropyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCCOc2ccccc2)CC1.I |
| InChI | InChI=1S/C16H25N3O.HI/c1-14-8-11-19(12-9-14)16(17)18-10-5-13-20-15-6-3-2-4-7-15;/h2-4,6-7,14H,5,8-13H2,1H3,(H2,17,18);1H |
| InChIKey | QDQOJKABVZJTQP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|