C16H28IN5 — CID 110928110
4-methyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 110928110) has the molecular formula C16H28IN5 and a molecular weight of 417.34 g/mol. Its IUPAC name is 4-methyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-methyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110928110 |
| Molecular Formula | C16H28IN5 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-methyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCCCNc2ccccn2)CC1.I |
| InChI | InChI=1S/C16H27N5.HI/c1-14-7-12-21(13-8-14)16(17)20-11-5-4-10-19-15-6-2-3-9-18-15;/h2-3,6,9,14H,4-5,7-8,10-13H2,1H3,(H2,17,20)(H,18,19);1H |
| InChIKey | GRTXXWGWMFDYQI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|