C21H29N5 — CID 111097205
N-phenyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide (PubChem CID 111097205) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is N-phenyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide.
| Compound Name | N-phenyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111097205 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | N-phenyl-N'-[4-(pyridin-2-ylamino)butyl]piperidine-1-carboximidamide |
| SMILES | c1ccc(N/C(=N/CCCCNc2ccccn2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N5/c1-3-11-19(12-4-1)25-21(26-17-9-2-10-18-26)24-16-8-7-15-23-20-13-5-6-14-22-20/h1,3-6,11-14H,2,7-10,15-18H2,(H,22,23)(H,24,25) |
| InChIKey | GHYUKNKHCPCYLD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|