C16H26IN3O2S — CID 110920487
N'-[3-(benzenesulfonyl)propyl]-4-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 110920487) has the molecular formula C16H26IN3O2S and a molecular weight of 451.37 g/mol. Its IUPAC name is N'-[3-(benzenesulfonyl)propyl]-4-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(benzenesulfonyl)propyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110920487 |
| Molecular Formula | C16H26IN3O2S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | N'-[3-(benzenesulfonyl)propyl]-4-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCN(/C(N)=N/CCCS(=O)(=O)c2ccccc2)CC1.I |
| InChI | InChI=1S/C16H25N3O2S.HI/c1-14-8-11-19(12-9-14)16(17)18-10-5-13-22(20,21)15-6-3-2-4-7-15;/h2-4,6-7,14H,5,8-13H2,1H3,(H2,17,18);1H |
| InChIKey | KATZFFNGCBHZGE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|