C10H15N3O2S — CID 51131551
2-[3-(benzenesulfonyl)propyl]guanidine (PubChem CID 51131551) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propyl]guanidine.
| Compound Name | 2-[3-(benzenesulfonyl)propyl]guanidine |
|---|---|
| PubChem CID | 51131551 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propyl]guanidine |
| SMILES | NC(N)=NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H15N3O2S/c11-10(12)13-7-4-8-16(14,15)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H4,11,12,13) |
| InChIKey | SFEFIFVDVFDCEV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|