C19H26IN3O2S — CID 111085346
2-[3-(benzenesulfonyl)propyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide (PubChem CID 111085346) has the molecular formula C19H26IN3O2S and a molecular weight of 487.41 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(benzenesulfonyl)propyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111085346 |
| Molecular Formula | C19H26IN3O2S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide |
| SMILES | CC(C)c1cccc(N/C(N)=N/CCCS(=O)(=O)c2ccccc2)c1.I |
| InChI | InChI=1S/C19H25N3O2S.HI/c1-15(2)16-8-6-9-17(14-16)22-19(20)21-12-7-13-25(23,24)18-10-4-3-5-11-18;/h3-6,8-11,14-15H,7,12-13H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | OMPUBFKMBNBRPT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|