C16H25N3O2 — CID 111025644
ethyl 4-[[amino-(3-propan-2-ylanilino)methylidene]amino]butanoate (PubChem CID 111025644) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is ethyl 4-[[amino-(3-propan-2-ylanilino)methylidene]amino]butanoate.
| Compound Name | ethyl 4-[[amino-(3-propan-2-ylanilino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 111025644 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethyl 4-[[amino-(3-propan-2-ylanilino)methylidene]amino]butanoate |
| SMILES | CCOC(=O)CCC/N=C(\N)Nc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-21-15(20)9-6-10-18-16(17)19-14-8-5-7-13(11-14)12(2)3/h5,7-8,11-12H,4,6,9-10H2,1-3H3,(H3,17,18,19) |
| InChIKey | ZMFNUCWAVIQGSI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|