C12H19N5O3S — CID 40548649
(2S)-2-(benzenesulfonamido)-5-(diaminomethylideneamino)pentanamide (PubChem CID 40548649) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 40548649 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H19N5O3S/c13-11(18)10(7-4-8-16-12(14)15)17-21(19,20)9-5-2-1-3-6-9/h1-3,5-6,10,17H,4,7-8H2,(H2,13,18)(H4,14,15,16)/t10-/m0/s1 |
| InChIKey | RDMCUKXYLHILOK-JTQLQIEISA-N |
| XLogP | -1.13 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|