C21H27FN6O4S — CID 10277363
(2R)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-fluorophenyl)sulfonylamino]pentanamide (PubChem CID 10277363) has the molecular formula C21H27FN6O4S and a molecular weight of 478.55 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-fluorophenyl)sulfonylamino]pentanamide.
| Compound Name | (2R)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-fluorophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 10277363 |
| Molecular Formula | C21H27FN6O4S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (2R)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-fluorophenyl)sulfonylamino]pentanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CCCN=C(N)N)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN6O4S/c22-15-8-10-16(11-9-15)33(31,32)28-17(7-4-12-26-21(24)25)20(30)27-18(19(23)29)13-14-5-2-1-3-6-14/h1-3,5-6,8-11,17-18,28H,4,7,12-13H2,(H2,23,29)(H,27,30)(H4,24,25,26)/t17-,18+/m1/s1 |
| InChIKey | ZCGIYZDQUCDODI-MSOLQXFVSA-N |
| XLogP | -0.26 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|