C22H30N6O4S — CID 142225285
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide (PubChem CID 142225285) has the molecular formula C22H30N6O4S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide.
| Compound Name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 142225285 |
| Molecular Formula | C22H30N6O4S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[(4-methylphenyl)sulfonylamino]pentanamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCCN=C(N)N)C(=O)N[C@@H](Cc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C22H30N6O4S/c1-15-9-11-17(12-10-15)33(31,32)28-18(8-5-13-26-22(24)25)21(30)27-19(20(23)29)14-16-6-3-2-4-7-16/h2-4,6-7,9-12,18-19,28H,5,8,13-14H2,1H3,(H2,23,29)(H,27,30)(H4,24,25,26)/t18?,19-/m0/s1 |
| InChIKey | LAUUZFLBNYQTGI-GGYWPGCISA-N |
| XLogP | -0.09 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|