C26H33N6O4S+ — CID 142225280
[(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]amino]-3-phenylpropanoyl]-methylazanium (PubChem CID 142225280) has the molecular formula C26H33N6O4S+ and a molecular weight of 525.66 g/mol. Its IUPAC name is [(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]amino]-3-phenylpropanoyl]-methylazanium.
| Compound Name | [(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]amino]-3-phenylpropanoyl]-methylazanium |
|---|---|
| PubChem CID | 142225280 |
| Molecular Formula | C26H33N6O4S+ |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-(naphthalen-2-ylsulfonylamino)pentanoyl]amino]-3-phenylpropanoyl]-methylazanium |
| SMILES | C[NH2+]C(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H32N6O4S/c1-29-24(33)23(16-18-8-3-2-4-9-18)31-25(34)22(12-7-15-30-26(27)28)32-37(35,36)21-14-13-19-10-5-6-11-20(19)17-21/h2-6,8-11,13-14,17,22-23,32H,7,12,15-16H2,1H3,(H,29,33)(H,31,34)(H4,27,28,30)/p+1/t22-,23-/m0/s1 |
| InChIKey | BRPQBJLOXSPEPX-GOTSBHOMSA-O |
| XLogP | -0.01 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|