C22H28FN5O5S — CID 124527713
(2R)-5-(diaminomethylideneamino)-2-[[(2R)-3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid (PubChem CID 124527713) has the molecular formula C22H28FN5O5S and a molecular weight of 493.56 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[[(2R)-3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[[(2R)-3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 124527713 |
| Molecular Formula | C22H28FN5O5S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[[(2R)-3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](Cc2ccc(F)cc2)C(=O)N[C@H](CCCN=C(N)N)C(=O)O)cc1 |
| InChI | InChI=1S/C22H28FN5O5S/c1-14-4-10-17(11-5-14)34(32,33)28-19(13-15-6-8-16(23)9-7-15)20(29)27-18(21(30)31)3-2-12-26-22(24)25/h4-11,18-19,28H,2-3,12-13H2,1H3,(H,27,29)(H,30,31)(H4,24,25,26)/t18-,19-/m1/s1 |
| InChIKey | RFEIWKLDHRXHFJ-RTBURBONSA-N |
| XLogP | 0.65 |
| TPSA | 176.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|