C25H24FN3O7S — CID 134540571
3-(4-fluorophenyl)-2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid (PubChem CID 134540571) has the molecular formula C25H24FN3O7S and a molecular weight of 529.55 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134540571 |
| Molecular Formula | C25H24FN3O7S |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-nitrophenyl)propanoyl]amino]propanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccc([N+](=O)[O-])cc2)C(=O)NC(Cc2ccc(F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C25H24FN3O7S/c1-16-2-12-21(13-3-16)37(35,36)28-22(14-18-6-10-20(11-7-18)29(33)34)24(30)27-23(25(31)32)15-17-4-8-19(26)9-5-17/h2-13,22-23,28H,14-15H2,1H3,(H,27,30)(H,31,32) |
| InChIKey | CANDZBQUXNGRQM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|