C22H26FN3O7S — CID 122689727
(2S)-2-[[(2S)-2-(tert-butylsulfonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 122689727) has the molecular formula C22H26FN3O7S and a molecular weight of 495.53 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(tert-butylsulfonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(tert-butylsulfonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 122689727 |
| Molecular Formula | C22H26FN3O7S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | (2S)-2-[[(2S)-2-(tert-butylsulfonylamino)-3-(4-nitrophenyl)propanoyl]amino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | CC(C)(C)S(=O)(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C22H26FN3O7S/c1-22(2,3)34(32,33)25-18(12-15-6-10-17(11-7-15)26(30)31)20(27)24-19(21(28)29)13-14-4-8-16(23)9-5-14/h4-11,18-19,25H,12-13H2,1-3H3,(H,24,27)(H,28,29)/t18-,19-/m0/s1 |
| InChIKey | PRJPBTNMIZEVHE-OALUTQOASA-N |
| XLogP | 2.17 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|