C11H9F3N2O5 — CID 54228721
(2S)-3-(4-nitrophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 54228721) has the molecular formula C11H9F3N2O5 and a molecular weight of 306.20 g/mol. Its IUPAC name is (2S)-3-(4-nitrophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | (2S)-3-(4-nitrophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54228721 |
| Molecular Formula | C11H9F3N2O5 |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (2S)-3-(4-nitrophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O5/c12-11(13,14)10(19)15-8(9(17)18)5-6-1-3-7(4-2-6)16(20)21/h1-4,8H,5H2,(H,15,19)(H,17,18)/t8-/m0/s1 |
| InChIKey | QHRNEDXPRFMWSK-QMMMGPOBSA-N |
| XLogP | 1.27 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|