C18H16N2O5 — CID 102534941
2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid (PubChem CID 102534941) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 102534941 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H16N2O5/c21-17(11-8-13-6-9-15(10-7-13)20(24)25)19-16(18(22)23)12-14-4-2-1-3-5-14/h1-11,16H,12H2,(H,19,21)(H,22,23)/b11-8+ |
| InChIKey | CLNQDSRAJOCNHJ-DHZHZOJOSA-N |
| XLogP | 2.42 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|