C13H13NO5 — CID 11687575
(Z)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 11687575) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is (Z)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 11687575 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (Z)-4-[[(1S)-1-carboxy-2-phenylethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H13NO5/c15-11(6-7-12(16)17)14-10(13(18)19)8-9-4-2-1-3-5-9/h1-7,10H,8H2,(H,14,15)(H,16,17)(H,18,19)/b7-6-/t10-/m0/s1 |
| InChIKey | OQGKOQBYSJCHHV-GFVADAIESA-N |
| XLogP | 0.44 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|