C14H15NO4 — CID 91974006
(E,5S)-5-acetamido-4-oxo-6-phenylhex-2-enoic acid (PubChem CID 91974006) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (E,5S)-5-acetamido-4-oxo-6-phenylhex-2-enoic acid.
| Compound Name | (E,5S)-5-acetamido-4-oxo-6-phenylhex-2-enoic acid |
|---|---|
| PubChem CID | 91974006 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (E,5S)-5-acetamido-4-oxo-6-phenylhex-2-enoic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H15NO4/c1-10(16)15-12(13(17)7-8-14(18)19)9-11-5-3-2-4-6-11/h2-8,12H,9H2,1H3,(H,15,16)(H,18,19)/b8-7+/t12-/m0/s1 |
| InChIKey | ZYNAHFQKYVRKBD-GUOLPTJISA-N |
| XLogP | 0.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|