C15H18N2O5 — CID 163717216
(2S)-2-(cyclopentanecarbonylamino)-3-(4-nitrophenyl)propanoic acid (PubChem CID 163717216) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2S)-2-(cyclopentanecarbonylamino)-3-(4-nitrophenyl)propanoic acid.
| Compound Name | (2S)-2-(cyclopentanecarbonylamino)-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 163717216 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (2S)-2-(cyclopentanecarbonylamino)-3-(4-nitrophenyl)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C15H18N2O5/c18-14(11-3-1-2-4-11)16-13(15(19)20)9-10-5-7-12(8-6-10)17(21)22/h5-8,11,13H,1-4,9H2,(H,16,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | KOKKVYWTGHCSIC-ZDUSSCGKSA-N |
| XLogP | 1.90 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|