C21H30N2O5 — CID 7316767
(4-nitrophenyl)methyl (2S)-4-methyl-2-[(4-methylcyclohexanecarbonyl)amino]pentanoate (PubChem CID 7316767) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S)-4-methyl-2-[(4-methylcyclohexanecarbonyl)amino]pentanoate.
| Compound Name | (4-nitrophenyl)methyl (2S)-4-methyl-2-[(4-methylcyclohexanecarbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 7316767 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (4-nitrophenyl)methyl (2S)-4-methyl-2-[(4-methylcyclohexanecarbonyl)amino]pentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C1CCC(C)CC1)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H30N2O5/c1-14(2)12-19(22-20(24)17-8-4-15(3)5-9-17)21(25)28-13-16-6-10-18(11-7-16)23(26)27/h6-7,10-11,14-15,17,19H,4-5,8-9,12-13H2,1-3H3,(H,22,24)/t15?,17?,19-/m0/s1 |
| InChIKey | FMZIQBWMDHISBE-KVWWFHCMSA-N |
| XLogP | 4.00 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|