C17H23NO3 — CID 171356618
benzyl (2R)-2-(cyclohexanecarbonylamino)propanoate (PubChem CID 171356618) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is benzyl (2R)-2-(cyclohexanecarbonylamino)propanoate.
| Compound Name | benzyl (2R)-2-(cyclohexanecarbonylamino)propanoate |
|---|---|
| PubChem CID | 171356618 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | benzyl (2R)-2-(cyclohexanecarbonylamino)propanoate |
| SMILES | C[C@@H](NC(=O)C1CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-13(18-16(19)15-10-6-3-7-11-15)17(20)21-12-14-8-4-2-5-9-14/h2,4-5,8-9,13,15H,3,6-7,10-12H2,1H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | PBBFIQFUEAHYGK-CYBMUJFWSA-N |
| XLogP | 2.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |