C20H30N2O4 — CID 10155562
benzyl (2S)-2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate (PubChem CID 10155562) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is benzyl (2S)-2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10155562 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | benzyl (2S)-2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)C(O)[C@H](N)CC1CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O4/c1-14(20(25)26-13-16-10-6-3-7-11-16)22-19(24)18(23)17(21)12-15-8-4-2-5-9-15/h3,6-7,10-11,14-15,17-18,23H,2,4-5,8-9,12-13,21H2,1H3,(H,22,24)/t14-,17+,18?/m0/s1 |
| InChIKey | PHISTBOOGVKVOJ-ZGRMHCKUSA-N |
| XLogP | 1.89 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |