C19H29FN2O2 — CID 70064214
(3R)-3-amino-4-cyclohexyl-N-[1-(2-fluorophenyl)propan-2-yl]-2-hydroxybutanamide (PubChem CID 70064214) has the molecular formula C19H29FN2O2 and a molecular weight of 336.45 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-N-[1-(2-fluorophenyl)propan-2-yl]-2-hydroxybutanamide.
| Compound Name | (3R)-3-amino-4-cyclohexyl-N-[1-(2-fluorophenyl)propan-2-yl]-2-hydroxybutanamide |
|---|---|
| PubChem CID | 70064214 |
| Molecular Formula | C19H29FN2O2 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-N-[1-(2-fluorophenyl)propan-2-yl]-2-hydroxybutanamide |
| SMILES | CC(Cc1ccccc1F)NC(=O)C(O)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C19H29FN2O2/c1-13(11-15-9-5-6-10-16(15)20)22-19(24)18(23)17(21)12-14-7-3-2-4-8-14/h5-6,9-10,13-14,17-18,23H,2-4,7-8,11-12,21H2,1H3,(H,22,24)/t13?,17-,18?/m1/s1 |
| InChIKey | MOLHQAPBSWVSHX-LKGZKJKYSA-N |
| XLogP | 2.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |