C19H28N2O5 — CID 91156388
benzyl 2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]oxyacetate (PubChem CID 91156388) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is benzyl 2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]oxyacetate.
| Compound Name | benzyl 2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]oxyacetate |
|---|---|
| PubChem CID | 91156388 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | benzyl 2-[[(3R)-3-amino-4-cyclohexyl-2-hydroxybutanoyl]amino]oxyacetate |
| SMILES | N[C@H](CC1CCCCC1)C(O)C(=O)NOCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28N2O5/c20-16(11-14-7-3-1-4-8-14)18(23)19(24)21-26-13-17(22)25-12-15-9-5-2-6-10-15/h2,5-6,9-10,14,16,18,23H,1,3-4,7-8,11-13,20H2,(H,21,24)/t16-,18?/m1/s1 |
| InChIKey | VIPHHZOWSXOGDD-PYUWXLGESA-N |
| XLogP | 1.44 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|