C18H28N2O2 — CID 67190825
benzyl N-[(3R)-3-amino-4-cyclohexylbutan-2-yl]carbamate (PubChem CID 67190825) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is benzyl N-[(3R)-3-amino-4-cyclohexylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[(3R)-3-amino-4-cyclohexylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67190825 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | benzyl N-[(3R)-3-amino-4-cyclohexylbutan-2-yl]carbamate |
| SMILES | CC(NC(=O)OCc1ccccc1)[C@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C18H28N2O2/c1-14(17(19)12-15-8-4-2-5-9-15)20-18(21)22-13-16-10-6-3-7-11-16/h3,6-7,10-11,14-15,17H,2,4-5,8-9,12-13,19H2,1H3,(H,20,21)/t14?,17-/m1/s1 |
| InChIKey | COUJGOAJIKOOFK-FBMWCMRBSA-N |
| XLogP | 3.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |