C19H27NO2 — CID 11109408
benzyl N-(1-cyclohexylpent-4-en-2-yl)carbamate (PubChem CID 11109408) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is benzyl N-(1-cyclohexylpent-4-en-2-yl)carbamate.
| Compound Name | benzyl N-(1-cyclohexylpent-4-en-2-yl)carbamate |
|---|---|
| PubChem CID | 11109408 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | benzyl N-(1-cyclohexylpent-4-en-2-yl)carbamate |
| SMILES | C=CCC(CC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO2/c1-2-9-18(14-16-10-5-3-6-11-16)20-19(21)22-15-17-12-7-4-8-13-17/h2,4,7-8,12-13,16,18H,1,3,5-6,9-11,14-15H2,(H,20,21) |
| InChIKey | VEAOGPUAIFFHNM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|