C21H29NO4 — CID 10383854
[(Z,4S)-5-cyclohexyl-4-(phenylmethoxycarbonylamino)pent-2-enyl] acetate (PubChem CID 10383854) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is [(Z,4S)-5-cyclohexyl-4-(phenylmethoxycarbonylamino)pent-2-enyl] acetate.
| Compound Name | [(Z,4S)-5-cyclohexyl-4-(phenylmethoxycarbonylamino)pent-2-enyl] acetate |
|---|---|
| PubChem CID | 10383854 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [(Z,4S)-5-cyclohexyl-4-(phenylmethoxycarbonylamino)pent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C\[C@H](CC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-17(23)25-14-8-13-20(15-18-9-4-2-5-10-18)22-21(24)26-16-19-11-6-3-7-12-19/h3,6-8,11-13,18,20H,2,4-5,9-10,14-16H2,1H3,(H,22,24)/b13-8-/t20-/m1/s1 |
| InChIKey | DCEUGISJWDRCNB-LOJRPPCJSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|