C19H28NO6P — CID 70426731
[2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-(2-methoxy-2-oxoethyl)phosphinic acid (PubChem CID 70426731) has the molecular formula C19H28NO6P and a molecular weight of 397.41 g/mol. Its IUPAC name is [2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-(2-methoxy-2-oxoethyl)phosphinic acid.
| Compound Name | [2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-(2-methoxy-2-oxoethyl)phosphinic acid |
|---|---|
| PubChem CID | 70426731 |
| Molecular Formula | C19H28NO6P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [2-cyclohexyl-1-(phenylmethoxycarbonylamino)ethyl]-(2-methoxy-2-oxoethyl)phosphinic acid |
| SMILES | COC(=O)CP(=O)(O)C(CC1CCCCC1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H28NO6P/c1-25-18(21)14-27(23,24)17(12-15-8-4-2-5-9-15)20-19(22)26-13-16-10-6-3-7-11-16/h3,6-7,10-11,15,17H,2,4-5,8-9,12-14H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | XNZMFCHCXDDPMA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|