C17H26NO5P — CID 102392968
benzyl N-[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]carbamate (PubChem CID 102392968) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is benzyl N-[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]carbamate.
| Compound Name | benzyl N-[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]carbamate |
|---|---|
| PubChem CID | 102392968 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | benzyl N-[(R)-cyclohexyl(dimethoxyphosphoryl)methyl]carbamate |
| SMILES | COP(=O)(OC)[C@@H](NC(=O)OCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H26NO5P/c1-21-24(20,22-2)16(15-11-7-4-8-12-15)18-17(19)23-13-14-9-5-3-6-10-14/h3,5-6,9-10,15-16H,4,7-8,11-13H2,1-2H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | MEKMDAMQONNHRL-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|