C18H20NO6P — CID 102190004
benzyl N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)carbamate (PubChem CID 102190004) has the molecular formula C18H20NO6P and a molecular weight of 377.33 g/mol. Its IUPAC name is benzyl N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)carbamate.
| Compound Name | benzyl N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 102190004 |
| Molecular Formula | C18H20NO6P |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | benzyl N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)carbamate |
| SMILES | COP(=O)(OC)C(NC(=O)OCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20NO6P/c1-23-26(22,24-2)17(16(20)15-11-7-4-8-12-15)19-18(21)25-13-14-9-5-3-6-10-14/h3-12,17H,13H2,1-2H3,(H,19,21) |
| InChIKey | NRNMOIDJCCVGKQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|