C12H16NO5P — CID 102237286
N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)acetamide (PubChem CID 102237286) has the molecular formula C12H16NO5P and a molecular weight of 285.24 g/mol. Its IUPAC name is N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)acetamide.
| Compound Name | N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 102237286 |
| Molecular Formula | C12H16NO5P |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-(1-dimethoxyphosphoryl-2-oxo-2-phenylethyl)acetamide |
| SMILES | COP(=O)(OC)C(NC(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16NO5P/c1-9(14)13-12(19(16,17-2)18-3)11(15)10-7-5-4-6-8-10/h4-8,12H,1-3H3,(H,13,14) |
| InChIKey | DPRWCCJQPZZKAM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|