C14H20NO6P — CID 2133146
methyl N-[(1S)-1-diethoxyphosphoryl-2-oxo-2-phenylethyl]carbamate (PubChem CID 2133146) has the molecular formula C14H20NO6P and a molecular weight of 329.29 g/mol. Its IUPAC name is methyl N-[(1S)-1-diethoxyphosphoryl-2-oxo-2-phenylethyl]carbamate.
| Compound Name | methyl N-[(1S)-1-diethoxyphosphoryl-2-oxo-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 2133146 |
| Molecular Formula | C14H20NO6P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | methyl N-[(1S)-1-diethoxyphosphoryl-2-oxo-2-phenylethyl]carbamate |
| SMILES | CCOP(=O)(OCC)[C@H](NC(=O)OC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20NO6P/c1-4-20-22(18,21-5-2)13(15-14(17)19-3)12(16)11-9-7-6-8-10-11/h6-10,13H,4-5H2,1-3H3,(H,15,17)/t13-/m0/s1 |
| InChIKey | WDWBXHJCRBUCSS-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|