C23H22NO4P — CID 3090786
ethyl N-(1-diphenylphosphoryl-2-oxo-2-phenylethyl)carbamate (PubChem CID 3090786) has the molecular formula C23H22NO4P and a molecular weight of 407.41 g/mol. Its IUPAC name is ethyl N-(1-diphenylphosphoryl-2-oxo-2-phenylethyl)carbamate.
| Compound Name | ethyl N-(1-diphenylphosphoryl-2-oxo-2-phenylethyl)carbamate |
|---|---|
| PubChem CID | 3090786 |
| Molecular Formula | C23H22NO4P |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl N-(1-diphenylphosphoryl-2-oxo-2-phenylethyl)carbamate |
| SMILES | CCOC(=O)NC(C(=O)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22NO4P/c1-2-28-23(26)24-22(21(25)18-12-6-3-7-13-18)29(27,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,22H,2H2,1H3,(H,24,26) |
| InChIKey | HCYMYNFYSGDIGL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|