C16H24NO7P — CID 11132476
ethyl 2-diethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate (PubChem CID 11132476) has the molecular formula C16H24NO7P and a molecular weight of 373.34 g/mol. Its IUPAC name is ethyl 2-diethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate.
| Compound Name | ethyl 2-diethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 11132476 |
| Molecular Formula | C16H24NO7P |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | ethyl 2-diethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate |
| SMILES | CCOC(=O)C(NC(=O)OCc1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H24NO7P/c1-4-21-15(18)14(25(20,23-5-2)24-6-3)17-16(19)22-12-13-10-8-7-9-11-13/h7-11,14H,4-6,12H2,1-3H3,(H,17,19) |
| InChIKey | OZBQRVNDIMNQBJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|