C16H26NO4P — CID 10426575
benzyl N-[1-[ethoxy(methyl)phosphoryl]-3-methylbutyl]carbamate (PubChem CID 10426575) has the molecular formula C16H26NO4P and a molecular weight of 327.36 g/mol. Its IUPAC name is benzyl N-[1-[ethoxy(methyl)phosphoryl]-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[1-[ethoxy(methyl)phosphoryl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 10426575 |
| Molecular Formula | C16H26NO4P |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | benzyl N-[1-[ethoxy(methyl)phosphoryl]-3-methylbutyl]carbamate |
| SMILES | CCOP(C)(=O)C(CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H26NO4P/c1-5-21-22(4,19)15(11-13(2)3)17-16(18)20-12-14-9-7-6-8-10-14/h6-10,13,15H,5,11-12H2,1-4H3,(H,17,18) |
| InChIKey | NQMRTTYJEXJISJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|