C21H27N2O5P — CID 57404222
benzyl N-[1-[methoxy(phenylcarbamoyl)phosphoryl]-3-methylbutyl]carbamate (PubChem CID 57404222) has the molecular formula C21H27N2O5P and a molecular weight of 418.43 g/mol. Its IUPAC name is benzyl N-[1-[methoxy(phenylcarbamoyl)phosphoryl]-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[1-[methoxy(phenylcarbamoyl)phosphoryl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 57404222 |
| Molecular Formula | C21H27N2O5P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | benzyl N-[1-[methoxy(phenylcarbamoyl)phosphoryl]-3-methylbutyl]carbamate |
| SMILES | COP(=O)(C(=O)Nc1ccccc1)C(CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H27N2O5P/c1-16(2)14-19(23-20(24)28-15-17-10-6-4-7-11-17)29(26,27-3)21(25)22-18-12-8-5-9-13-18/h4-13,16,19H,14-15H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | XAXSUNCAIYFETB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|