C27H32NO5P — CID 15855202
benzyl N-[1-bis(phenylmethoxy)phosphoryl-3-methylbutyl]carbamate (PubChem CID 15855202) has the molecular formula C27H32NO5P and a molecular weight of 481.53 g/mol. Its IUPAC name is benzyl N-[1-bis(phenylmethoxy)phosphoryl-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[1-bis(phenylmethoxy)phosphoryl-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 15855202 |
| Molecular Formula | C27H32NO5P |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | benzyl N-[1-bis(phenylmethoxy)phosphoryl-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)P(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H32NO5P/c1-22(2)18-26(28-27(29)31-19-23-12-6-3-7-13-23)34(30,32-20-24-14-8-4-9-15-24)33-21-25-16-10-5-11-17-25/h3-17,22,26H,18-21H2,1-2H3,(H,28,29) |
| InChIKey | SDUPZEXUAMVUAJ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|