C12H18NO5P — CID 12524618
[2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphonic acid (PubChem CID 12524618) has the molecular formula C12H18NO5P and a molecular weight of 287.25 g/mol. Its IUPAC name is [2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphonic acid.
| Compound Name | [2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphonic acid |
|---|---|
| PubChem CID | 12524618 |
| Molecular Formula | C12H18NO5P |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [2-methyl-1-(phenylmethoxycarbonylamino)propyl]phosphonic acid |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C12H18NO5P/c1-9(2)11(19(15,16)17)13-12(14)18-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,13,14)(H2,15,16,17) |
| InChIKey | KLSUPQBVQYSGSS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|