C26H30NO5PS2 — CID 53318677
benzyl N-[(1S)-1-bis(4-methylsulfanylphenoxy)phosphoryl-2-methylpropyl]carbamate (PubChem CID 53318677) has the molecular formula C26H30NO5PS2 and a molecular weight of 531.64 g/mol. Its IUPAC name is benzyl N-[(1S)-1-bis(4-methylsulfanylphenoxy)phosphoryl-2-methylpropyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-bis(4-methylsulfanylphenoxy)phosphoryl-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 53318677 |
| Molecular Formula | C26H30NO5PS2 |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | benzyl N-[(1S)-1-bis(4-methylsulfanylphenoxy)phosphoryl-2-methylpropyl]carbamate |
| SMILES | CSc1ccc(OP(=O)(Oc2ccc(SC)cc2)[C@H](NC(=O)OCc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C26H30NO5PS2/c1-19(2)25(27-26(28)30-18-20-8-6-5-7-9-20)33(29,31-21-10-14-23(34-3)15-11-21)32-22-12-16-24(35-4)17-13-22/h5-17,19,25H,18H2,1-4H3,(H,27,28)/t25-/m0/s1 |
| InChIKey | INSHPFGAKWKAOG-VWLOTQADSA-N |
| XLogP | 7.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|