C25H24F3N2O6P — CID 11135290
benzyl N-[(2S)-1-[(1-diphenoxyphosphoryl-2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 11135290) has the molecular formula C25H24F3N2O6P and a molecular weight of 536.44 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(1-diphenoxyphosphoryl-2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(1-diphenoxyphosphoryl-2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11135290 |
| Molecular Formula | C25H24F3N2O6P |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | benzyl N-[(2S)-1-[(1-diphenoxyphosphoryl-2,2,2-trifluoroethyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)NC(C(F)(F)F)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H24F3N2O6P/c1-18(29-24(32)34-17-19-11-5-2-6-12-19)22(31)30-23(25(26,27)28)37(33,35-20-13-7-3-8-14-20)36-21-15-9-4-10-16-21/h2-16,18,23H,17H2,1H3,(H,29,32)(H,30,31)/t18-,23?/m0/s1 |
| InChIKey | WUKNLEHEXWBRMK-XNUZUHMRSA-N |
| XLogP | 5.66 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|