C24H26NO5P — CID 26477193
benzyl N-[(1S)-1-diphenoxyphosphorylbutyl]carbamate (PubChem CID 26477193) has the molecular formula C24H26NO5P and a molecular weight of 439.45 g/mol. Its IUPAC name is benzyl N-[(1S)-1-diphenoxyphosphorylbutyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-diphenoxyphosphorylbutyl]carbamate |
|---|---|
| PubChem CID | 26477193 |
| Molecular Formula | C24H26NO5P |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | benzyl N-[(1S)-1-diphenoxyphosphorylbutyl]carbamate |
| SMILES | CCC[C@@H](NC(=O)OCc1ccccc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C24H26NO5P/c1-2-12-23(25-24(26)28-19-20-13-6-3-7-14-20)31(27,29-21-15-8-4-9-16-21)30-22-17-10-5-11-18-22/h3-11,13-18,23H,2,12,19H2,1H3,(H,25,26)/t23-/m0/s1 |
| InChIKey | UNYYGSNDHISNBR-QHCPKHFHSA-N |
| XLogP | 6.39 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|