C31H40NO5P — CID 53318202
benzyl N-[(1S)-1-bis(4-propan-2-ylphenoxy)phosphorylpentyl]carbamate (PubChem CID 53318202) has the molecular formula C31H40NO5P and a molecular weight of 537.64 g/mol. Its IUPAC name is benzyl N-[(1S)-1-bis(4-propan-2-ylphenoxy)phosphorylpentyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-bis(4-propan-2-ylphenoxy)phosphorylpentyl]carbamate |
|---|---|
| PubChem CID | 53318202 |
| Molecular Formula | C31H40NO5P |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | benzyl N-[(1S)-1-bis(4-propan-2-ylphenoxy)phosphorylpentyl]carbamate |
| SMILES | CCCC[C@@H](NC(=O)OCc1ccccc1)P(=O)(Oc1ccc(C(C)C)cc1)Oc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H40NO5P/c1-6-7-13-30(32-31(33)35-22-25-11-9-8-10-12-25)38(34,36-28-18-14-26(15-19-28)23(2)3)37-29-20-16-27(17-21-29)24(4)5/h8-12,14-21,23-24,30H,6-7,13,22H2,1-5H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | VPCBWQPHROCLDS-PMERELPUSA-N |
| XLogP | 9.03 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|