C23H24NO6P — CID 155539004
benzyl N-[2-(4-hydroxyphenyl)-1-[methoxy(phenoxy)phosphoryl]ethyl]carbamate (PubChem CID 155539004) has the molecular formula C23H24NO6P and a molecular weight of 441.42 g/mol. Its IUPAC name is benzyl N-[2-(4-hydroxyphenyl)-1-[methoxy(phenoxy)phosphoryl]ethyl]carbamate.
| Compound Name | benzyl N-[2-(4-hydroxyphenyl)-1-[methoxy(phenoxy)phosphoryl]ethyl]carbamate |
|---|---|
| PubChem CID | 155539004 |
| Molecular Formula | C23H24NO6P |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | benzyl N-[2-(4-hydroxyphenyl)-1-[methoxy(phenoxy)phosphoryl]ethyl]carbamate |
| SMILES | COP(=O)(Oc1ccccc1)C(Cc1ccc(O)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H24NO6P/c1-28-31(27,30-21-10-6-3-7-11-21)22(16-18-12-14-20(25)15-13-18)24-23(26)29-17-19-8-4-2-5-9-19/h2-15,22,25H,16-17H2,1H3,(H,24,26) |
| InChIKey | BWBJKZUTTXGODZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|