C25H28NO5PS2 — CID 53320000
benzyl N-[1-bis(4-methylsulfanylphenoxy)phosphorylpropyl]carbamate (PubChem CID 53320000) has the molecular formula C25H28NO5PS2 and a molecular weight of 517.61 g/mol. Its IUPAC name is benzyl N-[1-bis(4-methylsulfanylphenoxy)phosphorylpropyl]carbamate.
| Compound Name | benzyl N-[1-bis(4-methylsulfanylphenoxy)phosphorylpropyl]carbamate |
|---|---|
| PubChem CID | 53320000 |
| Molecular Formula | C25H28NO5PS2 |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | benzyl N-[1-bis(4-methylsulfanylphenoxy)phosphorylpropyl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)P(=O)(Oc1ccc(SC)cc1)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C25H28NO5PS2/c1-4-24(26-25(27)29-18-19-8-6-5-7-9-19)32(28,30-20-10-14-22(33-2)15-11-20)31-21-12-16-23(34-3)17-13-21/h5-17,24H,4,18H2,1-3H3,(H,26,27) |
| InChIKey | NDNVVCSBFSHJDF-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|