C25H31NO7S — CID 118017305
[2-methyl-1-(4-methylsulfanylphenoxy)carbonyloxypropyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 118017305) has the molecular formula C25H31NO7S and a molecular weight of 489.59 g/mol. Its IUPAC name is [2-methyl-1-(4-methylsulfanylphenoxy)carbonyloxypropyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [2-methyl-1-(4-methylsulfanylphenoxy)carbonyloxypropyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 118017305 |
| Molecular Formula | C25H31NO7S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [2-methyl-1-(4-methylsulfanylphenoxy)carbonyloxypropyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CSc1ccc(OC(=O)OC(OC(=O)[C@@H](NC(=O)OCc2ccccc2)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H31NO7S/c1-16(2)21(26-24(28)30-15-18-9-7-6-8-10-18)22(27)32-23(17(3)4)33-25(29)31-19-11-13-20(34-5)14-12-19/h6-14,16-17,21,23H,15H2,1-5H3,(H,26,28)/t21-,23?/m0/s1 |
| InChIKey | CRVPETWQAONDKH-BBQAJUCSSA-N |
| XLogP | 5.40 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|